C15H18FN3O3 — CID 113195779
2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)-N-(3-methylbutyl)acetamide (PubChem CID 113195779) has the molecular formula C15H18FN3O3 and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)-N-(3-methylbutyl)acetamide.
| Compound Name | 2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 113195779 |
| Molecular Formula | C15H18FN3O3 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)Cn1c(=O)c(=O)[nH]c2cc(F)ccc21 |
| InChI | InChI=1S/C15H18FN3O3/c1-9(2)5-6-17-13(20)8-19-12-4-3-10(16)7-11(12)18-14(21)15(19)22/h3-4,7,9H,5-6,8H2,1-2H3,(H,17,20)(H,18,21) |
| InChIKey | ACUNYFIPWXBKAC-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|