C16H12FN3O3 — CID 113195630
2-(2,3-dioxo-4H-quinoxalin-1-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 113195630) has the molecular formula C16H12FN3O3 and a molecular weight of 313.29 g/mol. Its IUPAC name is 2-(2,3-dioxo-4H-quinoxalin-1-yl)-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-(2,3-dioxo-4H-quinoxalin-1-yl)-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 113195630 |
| Molecular Formula | C16H12FN3O3 |
| Molecular Weight | 313.29 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 2-(2,3-dioxo-4H-quinoxalin-1-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | O=C(Cn1c(=O)c(=O)[nH]c2ccccc21)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H12FN3O3/c17-10-5-7-11(8-6-10)18-14(21)9-20-13-4-2-1-3-12(13)19-15(22)16(20)23/h1-8H,9H2,(H,18,21)(H,19,22) |
| InChIKey | DCUJABIWLXNCBR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.29 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|