C17H13F2N3O3 — CID 113195740
2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)-N-[(2-fluorophenyl)methyl]acetamide (PubChem CID 113195740) has the molecular formula C17H13F2N3O3 and a molecular weight of 345.31 g/mol. Its IUPAC name is 2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)-N-[(2-fluorophenyl)methyl]acetamide.
| Compound Name | 2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)-N-[(2-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 113195740 |
| Molecular Formula | C17H13F2N3O3 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 2-(6-fluoro-2,3-dioxo-4H-quinoxalin-1-yl)-N-[(2-fluorophenyl)methyl]acetamide |
| SMILES | O=C(Cn1c(=O)c(=O)[nH]c2cc(F)ccc21)NCc1ccccc1F |
| InChI | InChI=1S/C17H13F2N3O3/c18-11-5-6-14-13(7-11)21-16(24)17(25)22(14)9-15(23)20-8-10-3-1-2-4-12(10)19/h1-7H,8-9H2,(H,20,23)(H,21,24) |
| InChIKey | MCIZLUQMKUKONB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|