C17H12N4O3 — CID 113195702
N-(3-cyanophenyl)-2-(2,3-dioxo-4H-quinoxalin-1-yl)acetamide (PubChem CID 113195702) has the molecular formula C17H12N4O3 and a molecular weight of 320.31 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(2,3-dioxo-4H-quinoxalin-1-yl)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(2,3-dioxo-4H-quinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 113195702 |
| Molecular Formula | C17H12N4O3 |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | N-(3-cyanophenyl)-2-(2,3-dioxo-4H-quinoxalin-1-yl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)Cn2c(=O)c(=O)[nH]c3ccccc32)c1 |
| InChI | InChI=1S/C17H12N4O3/c18-9-11-4-3-5-12(8-11)19-15(22)10-21-14-7-2-1-6-13(14)20-16(23)17(21)24/h1-8H,10H2,(H,19,22)(H,20,23) |
| InChIKey | OVCFOLANQNOLRG-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 107.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|