C19H16N4OS — CID 4784969
N-(3-cyanophenyl)-2-(2-prop-2-enylsulfanylbenzimidazol-1-yl)acetamide (PubChem CID 4784969) has the molecular formula C19H16N4OS and a molecular weight of 348.43 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(2-prop-2-enylsulfanylbenzimidazol-1-yl)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(2-prop-2-enylsulfanylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 4784969 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | N-(3-cyanophenyl)-2-(2-prop-2-enylsulfanylbenzimidazol-1-yl)acetamide |
| SMILES | C=CCSc1nc2ccccc2n1CC(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C19H16N4OS/c1-2-10-25-19-22-16-8-3-4-9-17(16)23(19)13-18(24)21-15-7-5-6-14(11-15)12-20/h2-9,11H,1,10,13H2,(H,21,24) |
| InChIKey | RCINHNBBFGXASN-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|