C21H24N4O3 — CID 113195699
N-[4-(diethylamino)-2-methylphenyl]-2-(2,3-dioxo-4H-quinoxalin-1-yl)acetamide (PubChem CID 113195699) has the molecular formula C21H24N4O3 and a molecular weight of 380.45 g/mol. Its IUPAC name is N-[4-(diethylamino)-2-methylphenyl]-2-(2,3-dioxo-4H-quinoxalin-1-yl)acetamide.
| Compound Name | N-[4-(diethylamino)-2-methylphenyl]-2-(2,3-dioxo-4H-quinoxalin-1-yl)acetamide |
|---|---|
| PubChem CID | 113195699 |
| Molecular Formula | C21H24N4O3 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[4-(diethylamino)-2-methylphenyl]-2-(2,3-dioxo-4H-quinoxalin-1-yl)acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cn2c(=O)c(=O)[nH]c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C21H24N4O3/c1-4-24(5-2)15-10-11-16(14(3)12-15)22-19(26)13-25-18-9-7-6-8-17(18)23-20(27)21(25)28/h6-12H,4-5,13H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | RNRHQDKDRGWIMO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 87.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|