C20H21N3O4S — CID 110396494
N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide (PubChem CID 110396494) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide.
| Compound Name | N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 110396494 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]-5,6,7,8-tetrahydronaphthalene-2-sulfonamide |
| SMILES | O=c1[nH]c2ccccc2n(CCNS(=O)(=O)c2ccc3c(c2)CCCC3)c1=O |
| InChI | InChI=1S/C20H21N3O4S/c24-19-20(25)23(18-8-4-3-7-17(18)22-19)12-11-21-28(26,27)16-10-9-14-5-1-2-6-15(14)13-16/h3-4,7-10,13,21H,1-2,5-6,11-12H2,(H,22,24) |
| InChIKey | GWMJIYXDALKSMQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|