C16H17N3O3S — CID 110400828
3-methyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]benzenesulfonamide (PubChem CID 110400828) has the molecular formula C16H17N3O3S and a molecular weight of 331.40 g/mol. Its IUPAC name is 3-methyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]benzenesulfonamide.
| Compound Name | 3-methyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 110400828 |
| Molecular Formula | C16H17N3O3S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 3-methyl-N-[2-(2-oxo-3H-benzimidazol-1-yl)ethyl]benzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NCCn2c(=O)[nH]c3ccccc32)c1 |
| InChI | InChI=1S/C16H17N3O3S/c1-12-5-4-6-13(11-12)23(21,22)17-9-10-19-15-8-3-2-7-14(15)18-16(19)20/h2-8,11,17H,9-10H2,1H3,(H,18,20) |
| InChIKey | MMUDPVJEZKWESD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |