C14H13N3O4S2 — CID 110396503
N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 110396503) has the molecular formula C14H13N3O4S2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 110396503 |
| Molecular Formula | C14H13N3O4S2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | N-[2-(2,3-dioxo-4H-quinoxalin-1-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | O=c1[nH]c2ccccc2n(CCNS(=O)(=O)c2cccs2)c1=O |
| InChI | InChI=1S/C14H13N3O4S2/c18-13-14(19)17(11-5-2-1-4-10(11)16-13)8-7-15-23(20,21)12-6-3-9-22-12/h1-6,9,15H,7-8H2,(H,16,18) |
| InChIKey | GGECOUADXSJYOW-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|