C15H15N3O4S2 — CID 71835322
N-[2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 71835322) has the molecular formula C15H15N3O4S2 and a molecular weight of 365.44 g/mol. Its IUPAC name is N-[2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-[2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 71835322 |
| Molecular Formula | C15H15N3O4S2 |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | N-[2-(1-methyl-2,4-dioxoquinazolin-3-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | Cn1c(=O)n(CCNS(=O)(=O)c2cccs2)c(=O)c2ccccc21 |
| InChI | InChI=1S/C15H15N3O4S2/c1-17-12-6-3-2-5-11(12)14(19)18(15(17)20)9-8-16-24(21,22)13-7-4-10-23-13/h2-7,10,16H,8-9H2,1H3 |
| InChIKey | YOZJPFGPVLVGTQ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |