C41H66N4O2 — CID 163264519
(2E,4Z)-2,5-dimethylocta-2,4-dienal;ethane;1-[(1Z)-1-[3-ethyl-4-(methylamino)phenyl]buta-1,3-dienyl]-N-(3-methylpentyl)-N,5-dipropylpyrazole-3-carboxamide (PubChem CID 163264519) has the molecular formula C41H66N4O2 and a molecular weight of 647.01 g/mol. Its IUPAC name is (2E,4Z)-2,5-dimethylocta-2,4-dienal;ethane;1-[(1Z)-1-[3-ethyl-4-(methylamino)phenyl]buta-1,3-dienyl]-N-(3-methylpentyl)-N,5-dipropylpyrazole-3-carboxamide.
| Compound Name | (2E,4Z)-2,5-dimethylocta-2,4-dienal;ethane;1-[(1Z)-1-[3-ethyl-4-(methylamino)phenyl]buta-1,3-dienyl]-N-(3-methylpentyl)-N,5-dipropylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 163264519 |
| Molecular Formula | C41H66N4O2 |
| Molecular Weight | 647.01 g/mol |
| Exact Mass | 646.52 |
| IUPAC Name | (2E,4Z)-2,5-dimethylocta-2,4-dienal;ethane;1-[(1Z)-1-[3-ethyl-4-(methylamino)phenyl]buta-1,3-dienyl]-N-(3-methylpentyl)-N,5-dipropylpyrazole-3-carboxamide |
| SMILES | C=C/C=C(/c1ccc(NC)c(CC)c1)n1nc(C(=O)N(CCC)CCC(C)CC)cc1CCC.CC.CCC/C(C)=C\C=C(/C)C=O |
| InChI | InChI=1S/C29H44N4O.C10H16O.C2H6/c1-8-13-25-21-27(29(34)32(18-10-3)19-17-22(6)11-4)31-33(25)28(14-9-2)24-15-16-26(30-7)23(12-5)20-24;1-4-5-9(2)6-7-10(3)8-11;1-2/h9,14-16,20-22,30H,2,8,10-13,17-19H2,1,3-7H3;6-8H,4-5H2,1-3H3;1-2H3/b28-14-;9-6-,10-7+; |
| InChIKey | XYNJWBGWKKVWIC-XQHVVITHSA-N |
| XLogP | 10.71 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.01 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|