About 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine
2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine (PubChem CID 163266511) has the molecular formula C12H26N2
and a molecular weight of 198.35 g/mol. Its IUPAC name is 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine |
| PubChem CID | 163266511 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine |
| SMILES | CC=C(C)C.CNCCC1(C)CNC1 |
| InChI | InChI=1S/C7H16N2.C5H10/c1-7(3-4-8-2)5-9-6-7;1-4-5(2)3/h8-9H,3-6H2,1-2H3;4H,1-3H3 |
| InChIKey | AEIXLIWDFOHOKQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine?
The IUPAC name of 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine (CID 163266511) is 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine.
What is the SMILES notation for 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine?
The canonical SMILES for 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine is CC=C(C)C.CNCCC1(C)CNC1.
What is the InChIKey of 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine?
The InChIKey is AEIXLIWDFOHOKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C5H10/c1-7(3-4-8-2)5-9-6-7;1-4-5(2)3/h8-9H,3-6H2,1-2H3;4H,1-3H3.
What are the key properties of 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine?
2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine has a molecular weight of 198.35 g/mol, XLogP of 2.18, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbut-2-ene;N-methyl-2-(3-methylazetidin-3-yl)ethanamine is sourced from PubChem (CID 163266511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).