C25H23N7O2 — CID 163266571
4-[5-[3-(3-methylphenyl)pyrazol-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)pyrazolo[1,5-a]pyrimidin-7-yl]morpholine (PubChem CID 163266571) has the molecular formula C25H23N7O2 and a molecular weight of 453.51 g/mol. Its IUPAC name is 4-[5-[3-(3-methylphenyl)pyrazol-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)pyrazolo[1,5-a]pyrimidin-7-yl]morpholine.
| Compound Name | 4-[5-[3-(3-methylphenyl)pyrazol-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)pyrazolo[1,5-a]pyrimidin-7-yl]morpholine |
|---|---|
| PubChem CID | 163266571 |
| Molecular Formula | C25H23N7O2 |
| Molecular Weight | 453.51 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 4-[5-[3-(3-methylphenyl)pyrazol-1-yl]-2-(1-oxidopyridin-1-ium-4-yl)pyrazolo[1,5-a]pyrimidin-7-yl]morpholine |
| SMILES | Cc1cccc(-c2ccn(-c3cc(N4CCOCC4)n4nc(-c5cc[n+]([O-])cc5)cc4n3)n2)c1 |
| InChI | InChI=1S/C25H23N7O2/c1-18-3-2-4-20(15-18)21-7-10-31(27-21)23-17-25(29-11-13-34-14-12-29)32-24(26-23)16-22(28-32)19-5-8-30(33)9-6-19/h2-10,15-17H,11-14H2,1H3 |
| InChIKey | AZTYUFOBVPAUJB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 87.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|