C23H26N8O — CID 156832136
4-[6-[3-(3-methylphenyl)pyrazol-1-yl]-2-[3-(triazol-2-yl)propyl]pyrimidin-4-yl]morpholine (PubChem CID 156832136) has the molecular formula C23H26N8O and a molecular weight of 430.52 g/mol. Its IUPAC name is 4-[6-[3-(3-methylphenyl)pyrazol-1-yl]-2-[3-(triazol-2-yl)propyl]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[6-[3-(3-methylphenyl)pyrazol-1-yl]-2-[3-(triazol-2-yl)propyl]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 156832136 |
| Molecular Formula | C23H26N8O |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | 4-[6-[3-(3-methylphenyl)pyrazol-1-yl]-2-[3-(triazol-2-yl)propyl]pyrimidin-4-yl]morpholine |
| SMILES | Cc1cccc(-c2ccn(-c3cc(N4CCOCC4)nc(CCCn4nccn4)n3)n2)c1 |
| InChI | InChI=1S/C23H26N8O/c1-18-4-2-5-19(16-18)20-7-11-30(28-20)23-17-22(29-12-14-32-15-13-29)26-21(27-23)6-3-10-31-24-8-9-25-31/h2,4-5,7-9,11,16-17H,3,6,10,12-15H2,1H3 |
| InChIKey | BKOCJBHNHUIGMV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 86.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |