C21H21ClN6O — CID 169032485
4-[2-(chloromethyl)-5-[3-(3-methylphenyl)pyrazol-1-yl]-1H-imidazo[4,5-b]pyridin-7-yl]morpholine (PubChem CID 169032485) has the molecular formula C21H21ClN6O and a molecular weight of 408.89 g/mol. Its IUPAC name is 4-[2-(chloromethyl)-5-[3-(3-methylphenyl)pyrazol-1-yl]-1H-imidazo[4,5-b]pyridin-7-yl]morpholine.
| Compound Name | 4-[2-(chloromethyl)-5-[3-(3-methylphenyl)pyrazol-1-yl]-1H-imidazo[4,5-b]pyridin-7-yl]morpholine |
|---|---|
| PubChem CID | 169032485 |
| Molecular Formula | C21H21ClN6O |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-[2-(chloromethyl)-5-[3-(3-methylphenyl)pyrazol-1-yl]-1H-imidazo[4,5-b]pyridin-7-yl]morpholine |
| SMILES | Cc1cccc(-c2ccn(-c3cc(N4CCOCC4)c4[nH]c(CCl)nc4n3)n2)c1 |
| InChI | InChI=1S/C21H21ClN6O/c1-14-3-2-4-15(11-14)16-5-6-28(26-16)19-12-17(27-7-9-29-10-8-27)20-21(25-19)24-18(13-22)23-20/h2-6,11-12H,7-10,13H2,1H3,(H,23,24,25) |
| InChIKey | DPXBMZYBQAUQRS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|