C24H26N6O — CID 172568696
4-[4-[3-(3-methylphenyl)pyrazol-1-yl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-6-yl]morpholine (PubChem CID 172568696) has the molecular formula C24H26N6O and a molecular weight of 414.51 g/mol. Its IUPAC name is 4-[4-[3-(3-methylphenyl)pyrazol-1-yl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-6-yl]morpholine.
| Compound Name | 4-[4-[3-(3-methylphenyl)pyrazol-1-yl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-6-yl]morpholine |
|---|---|
| PubChem CID | 172568696 |
| Molecular Formula | C24H26N6O |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 4-[4-[3-(3-methylphenyl)pyrazol-1-yl]-1,3,8-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraen-6-yl]morpholine |
| SMILES | Cc1cccc(-c2ccn(-c3cc(N4CCOCC4)c4nc5n(c4n3)CCCC5)n2)c1 |
| InChI | InChI=1S/C24H26N6O/c1-17-5-4-6-18(15-17)19-8-10-30(27-19)22-16-20(28-11-13-31-14-12-28)23-24(26-22)29-9-3-2-7-21(29)25-23/h4-6,8,10,15-16H,2-3,7,9,11-14H2,1H3 |
| InChIKey | NUKBJEIOBFGPJZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 61.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |