C23H26N4O2 — CID 163268092
N-[5-(4-cyano-3,5-dimethylphenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-methylpyrimidine-5-carboxamide (PubChem CID 163268092) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[5-(4-cyano-3,5-dimethylphenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-methylpyrimidine-5-carboxamide.
| Compound Name | N-[5-(4-cyano-3,5-dimethylphenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 163268092 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[5-(4-cyano-3,5-dimethylphenoxy)-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl]-2-methylpyrimidine-5-carboxamide |
| SMILES | Cc1ncc(C(=O)NC2CC3CC(Oc4cc(C)c(C#N)c(C)c4)CC3C2)cn1 |
| InChI | InChI=1S/C23H26N4O2/c1-13-4-20(5-14(2)22(13)10-24)29-21-8-16-6-19(7-17(16)9-21)27-23(28)18-11-25-15(3)26-12-18/h4-5,11-12,16-17,19,21H,6-9H2,1-3H3,(H,27,28) |
| InChIKey | GDCINCBBUCLFNF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 87.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |