C30H61NS — CID 163268412
2-[(E)-11-butan-2-yl-12,15,16-trimethyl-8-propylheptadec-3-en-7-yl]sulfanyl-N-methylethanamine (PubChem CID 163268412) has the molecular formula C30H61NS and a molecular weight of 467.89 g/mol. Its IUPAC name is 2-[(E)-11-butan-2-yl-12,15,16-trimethyl-8-propylheptadec-3-en-7-yl]sulfanyl-N-methylethanamine.
| Compound Name | 2-[(E)-11-butan-2-yl-12,15,16-trimethyl-8-propylheptadec-3-en-7-yl]sulfanyl-N-methylethanamine |
|---|---|
| PubChem CID | 163268412 |
| Molecular Formula | C30H61NS |
| Molecular Weight | 467.89 g/mol |
| Exact Mass | 467.45 |
| IUPAC Name | 2-[(E)-11-butan-2-yl-12,15,16-trimethyl-8-propylheptadec-3-en-7-yl]sulfanyl-N-methylethanamine |
| SMILES | CC/C=C/CCC(SCCNC)C(CCC)CCC(C(C)CC)C(C)CCC(C)C(C)C |
| InChI | InChI=1S/C30H61NS/c1-10-13-14-15-17-30(32-23-22-31-9)28(16-11-2)20-21-29(25(6)12-3)27(8)19-18-26(7)24(4)5/h13-14,24-31H,10-12,15-23H2,1-9H3/b14-13+ |
| InChIKey | LBQQLXPMDJGRJA-BUHFOSPRSA-N |
| XLogP | 9.62 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.89 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|