C25H32N4O5 — CID 163268814
N-[2-[2-[[(Z)-2-(methylamino)but-2-enoyl]amino]ethoxy]ethyl]-6-oxo-1-phenylmethoxy-5-prop-1-en-2-ylpyridine-2-carboxamide (PubChem CID 163268814) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-[2-[2-[[(Z)-2-(methylamino)but-2-enoyl]amino]ethoxy]ethyl]-6-oxo-1-phenylmethoxy-5-prop-1-en-2-ylpyridine-2-carboxamide.
| Compound Name | N-[2-[2-[[(Z)-2-(methylamino)but-2-enoyl]amino]ethoxy]ethyl]-6-oxo-1-phenylmethoxy-5-prop-1-en-2-ylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 163268814 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-[2-[2-[[(Z)-2-(methylamino)but-2-enoyl]amino]ethoxy]ethyl]-6-oxo-1-phenylmethoxy-5-prop-1-en-2-ylpyridine-2-carboxamide |
| SMILES | C=C(C)c1ccc(C(=O)NCCOCCNC(=O)/C(=C/C)NC)n(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C25H32N4O5/c1-5-21(26-4)23(30)27-13-15-33-16-14-28-24(31)22-12-11-20(18(2)3)25(32)29(22)34-17-19-9-7-6-8-10-19/h5-12,26H,2,13-17H2,1,3-4H3,(H,27,30)(H,28,31)/b21-5- |
| InChIKey | NJWRJWBOHFJSKY-SQFVCTCFSA-N |
| XLogP | 1.50 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|