C31H39N5O9 — CID 54681027
1-N-[2-[2-[(1-benzyl-3-hydroxy-6-methyl-2-oxopyridine-4-carbonyl)amino]ethylamino]ethyl]-2,3-dihydroxy-4-N-[2-(2-methoxyethoxy)ethyl]benzene-1,4-dicarboxamide (PubChem CID 54681027) has the molecular formula C31H39N5O9 and a molecular weight of 625.68 g/mol. Its IUPAC name is 1-N-[2-[2-[(1-benzyl-3-hydroxy-6-methyl-2-oxopyridine-4-carbonyl)amino]ethylamino]ethyl]-2,3-dihydroxy-4-N-[2-(2-methoxyethoxy)ethyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N-[2-[2-[(1-benzyl-3-hydroxy-6-methyl-2-oxopyridine-4-carbonyl)amino]ethylamino]ethyl]-2,3-dihydroxy-4-N-[2-(2-methoxyethoxy)ethyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 54681027 |
| Molecular Formula | C31H39N5O9 |
| Molecular Weight | 625.68 g/mol |
| Exact Mass | 625.27 |
| IUPAC Name | 1-N-[2-[2-[(1-benzyl-3-hydroxy-6-methyl-2-oxopyridine-4-carbonyl)amino]ethylamino]ethyl]-2,3-dihydroxy-4-N-[2-(2-methoxyethoxy)ethyl]benzene-1,4-dicarboxamide |
| SMILES | COCCOCCNC(=O)c1ccc(C(=O)NCCNCCNC(=O)c2cc(C)n(Cc3ccccc3)c(=O)c2O)c(O)c1O |
| InChI | InChI=1S/C31H39N5O9/c1-20-18-24(27(39)31(43)36(20)19-21-6-4-3-5-7-21)30(42)34-13-11-32-10-12-33-28(40)22-8-9-23(26(38)25(22)37)29(41)35-14-15-45-17-16-44-2/h3-9,18,32,37-39H,10-17,19H2,1-2H3,(H,33,40)(H,34,42)(H,35,41) |
| InChIKey | MMUQOJMQTITXPN-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 200.48 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.68 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|