C19H42N4O — CID 163269334
3,3-dimethylbutan-1-amine;ethane;4-(piperazin-1-ylmethyl)piperidine-1-carbaldehyde (PubChem CID 163269334) has the molecular formula C19H42N4O and a molecular weight of 342.57 g/mol. Its IUPAC name is 3,3-dimethylbutan-1-amine;ethane;4-(piperazin-1-ylmethyl)piperidine-1-carbaldehyde.
| Compound Name | 3,3-dimethylbutan-1-amine;ethane;4-(piperazin-1-ylmethyl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 163269334 |
| Molecular Formula | C19H42N4O |
| Molecular Weight | 342.57 g/mol |
| Exact Mass | 342.34 |
| IUPAC Name | 3,3-dimethylbutan-1-amine;ethane;4-(piperazin-1-ylmethyl)piperidine-1-carbaldehyde |
| SMILES | CC.CC(C)(C)CCN.O=CN1CCC(CN2CCNCC2)CC1 |
| InChI | InChI=1S/C11H21N3O.C6H15N.C2H6/c15-10-14-5-1-11(2-6-14)9-13-7-3-12-4-8-13;1-6(2,3)4-5-7;1-2/h10-12H,1-9H2;4-5,7H2,1-3H3;1-2H3 |
| InChIKey | IFLDJIUENQBTHN-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.57 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|