C17H38N4O — CID 142391074
ethane;1-ethyl-4-(2-piperidin-1-ylethyl)piperazine;N-methylformamide (PubChem CID 142391074) has the molecular formula C17H38N4O and a molecular weight of 314.52 g/mol. Its IUPAC name is ethane;1-ethyl-4-(2-piperidin-1-ylethyl)piperazine;N-methylformamide.
| Compound Name | ethane;1-ethyl-4-(2-piperidin-1-ylethyl)piperazine;N-methylformamide |
|---|---|
| PubChem CID | 142391074 |
| Molecular Formula | C17H38N4O |
| Molecular Weight | 314.52 g/mol |
| Exact Mass | 314.30 |
| IUPAC Name | ethane;1-ethyl-4-(2-piperidin-1-ylethyl)piperazine;N-methylformamide |
| SMILES | CC.CCN1CCN(CCN2CCCCC2)CC1.CNC=O |
| InChI | InChI=1S/C13H27N3.C2H5NO.C2H6/c1-2-14-8-10-16(11-9-14)13-12-15-6-4-3-5-7-15;1-3-2-4;1-2/h2-13H2,1H3;2H,1H3,(H,3,4);1-2H3 |
| InChIKey | KIZCHUYUDRVDMI-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.52 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|