About N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde
N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde (PubChem CID 166106575) has the molecular formula C17H36N4O
and a molecular weight of 312.50 g/mol. Its IUPAC name is N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde.
Molecular Properties
| Compound Name | N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde |
| PubChem CID | 166106575 |
| Molecular Formula | C17H36N4O |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.29 |
| IUPAC Name | N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde |
| SMILES | CC(C)CN1CCN(CC2CCN(C=O)CC2)CC1.CNC |
| InChI | InChI=1S/C15H29N3O.C2H7N/c1-14(2)11-16-7-9-17(10-8-16)12-15-3-5-18(13-19)6-4-15;1-3-2/h13-15H,3-12H2,1-2H3;3H,1-2H3 |
| InChIKey | RKEIYPZQQDXMGT-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde?
The IUPAC name of N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde (CID 166106575) is N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde.
What is the SMILES notation for N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde?
The canonical SMILES for N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde is CC(C)CN1CCN(CC2CCN(C=O)CC2)CC1.CNC.
What is the InChIKey of N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde?
The InChIKey is RKEIYPZQQDXMGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29N3O.C2H7N/c1-14(2)11-16-7-9-17(10-8-16)12-15-3-5-18(13-19)6-4-15;1-3-2/h13-15H,3-12H2,1-2H3;3H,1-2H3.
What are the key properties of N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde?
N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde has a molecular weight of 312.50 g/mol, XLogP of 0.96, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylmethanamine;4-[[4-(2-methylpropyl)piperazin-1-yl]methyl]piperidine-1-carbaldehyde is sourced from PubChem (CID 166106575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).