About 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide
1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide (PubChem CID 153398657) has the molecular formula C15H33N5O
and a molecular weight of 299.46 g/mol. Its IUPAC name is 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide.
Molecular Properties
| Compound Name | 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide |
| PubChem CID | 153398657 |
| Molecular Formula | C15H33N5O |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.27 |
| IUPAC Name | 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide |
| SMILES | CCN1CCN(CCN2CCN(C)CC2)CC1.CNC=O |
| InChI | InChI=1S/C13H28N4.C2H5NO/c1-3-15-8-10-17(11-9-15)13-12-16-6-4-14(2)5-7-16;1-3-2-4/h3-13H2,1-2H3;2H,1H3,(H,3,4) |
| InChIKey | OWPPWABFSWAGQW-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 42.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide?
The IUPAC name of 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide (CID 153398657) is 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide.
What is the SMILES notation for 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide?
The canonical SMILES for 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide is CCN1CCN(CCN2CCN(C)CC2)CC1.CNC=O.
What is the InChIKey of 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide?
The InChIKey is OWPPWABFSWAGQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N4.C2H5NO/c1-3-15-8-10-17(11-9-15)13-12-16-6-4-14(2)5-7-16;1-3-2-4/h3-13H2,1-2H3;2H,1H3,(H,3,4).
What are the key properties of 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide?
1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide has a molecular weight of 299.46 g/mol, XLogP of -0.77, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4-[2-(4-methylpiperazin-1-yl)ethyl]piperazine;N-methylformamide is sourced from PubChem (CID 153398657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).