C21H28N2O2S2 — CID 163269987
S-[7-[methyl-(4-phenyl-1,3-thiazol-2-yl)amino]-7-oxoheptyl] 2-methylpropanethioate (PubChem CID 163269987) has the molecular formula C21H28N2O2S2 and a molecular weight of 404.60 g/mol. Its IUPAC name is S-[7-[methyl-(4-phenyl-1,3-thiazol-2-yl)amino]-7-oxoheptyl] 2-methylpropanethioate.
| Compound Name | S-[7-[methyl-(4-phenyl-1,3-thiazol-2-yl)amino]-7-oxoheptyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 163269987 |
| Molecular Formula | C21H28N2O2S2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | S-[7-[methyl-(4-phenyl-1,3-thiazol-2-yl)amino]-7-oxoheptyl] 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SCCCCCCC(=O)N(C)c1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C21H28N2O2S2/c1-16(2)20(25)26-14-10-5-4-9-13-19(24)23(3)21-22-18(15-27-21)17-11-7-6-8-12-17/h6-8,11-12,15-16H,4-5,9-10,13-14H2,1-3H3 |
| InChIKey | ZUCVMWBWKRBBMV-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|