C24H33N5O5S2 — CID 143592962
6-[[amino(dihydroxy)-λ4-sulfanyl]amino]-N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)hexanamide;benzyl carbamate (PubChem CID 143592962) has the molecular formula C24H33N5O5S2 and a molecular weight of 535.69 g/mol. Its IUPAC name is 6-[[amino(dihydroxy)-λ4-sulfanyl]amino]-N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)hexanamide;benzyl carbamate.
| Compound Name | 6-[[amino(dihydroxy)-λ4-sulfanyl]amino]-N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)hexanamide;benzyl carbamate |
|---|---|
| PubChem CID | 143592962 |
| Molecular Formula | C24H33N5O5S2 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.19 |
| IUPAC Name | 6-[[amino(dihydroxy)-λ4-sulfanyl]amino]-N-methyl-N-(4-phenyl-1,3-thiazol-2-yl)hexanamide;benzyl carbamate |
| SMILES | CN(C(=O)CCCCCNS(N)(O)O)c1nc(-c2ccccc2)cs1.NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H24N4O3S2.C8H9NO2/c1-20(15(21)10-6-3-7-11-18-25(17,22)23)16-19-14(12-24-16)13-8-4-2-5-9-13;9-8(10)11-6-7-4-2-1-3-5-7/h2,4-5,8-9,12,18,22-23H,3,6-7,10-11,17H2,1H3;1-5H,6H2,(H2,9,10) |
| InChIKey | NASJPOCBIBSWNT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 164.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|