C23H31N5O5S — CID 143592927
6-[[amino(dihydroxy)-λ4-sulfanyl]amino]-N-quinolin-3-ylhexanamide;benzyl carbamate (PubChem CID 143592927) has the molecular formula C23H31N5O5S and a molecular weight of 489.60 g/mol. Its IUPAC name is 6-[[amino(dihydroxy)-λ4-sulfanyl]amino]-N-quinolin-3-ylhexanamide;benzyl carbamate.
| Compound Name | 6-[[amino(dihydroxy)-λ4-sulfanyl]amino]-N-quinolin-3-ylhexanamide;benzyl carbamate |
|---|---|
| PubChem CID | 143592927 |
| Molecular Formula | C23H31N5O5S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | 6-[[amino(dihydroxy)-λ4-sulfanyl]amino]-N-quinolin-3-ylhexanamide;benzyl carbamate |
| SMILES | NC(=O)OCc1ccccc1.NS(O)(O)NCCCCCC(=O)Nc1cnc2ccccc2c1 |
| InChI | InChI=1S/C15H22N4O3S.C8H9NO2/c16-23(21,22)18-9-5-1-2-8-15(20)19-13-10-12-6-3-4-7-14(12)17-11-13;9-8(10)11-6-7-4-2-1-3-5-7/h3-4,6-7,10-11,18,21-22H,1-2,5,8-9,16H2,(H,19,20);1-5H,6H2,(H2,9,10) |
| InChIKey | QJUFRPXAIDVPMH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 172.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|