C21H28N4O5S — CID 143593142
4-[6-(aminosulfanylamino)hexanoylamino]benzoic acid;benzyl carbamate (PubChem CID 143593142) has the molecular formula C21H28N4O5S and a molecular weight of 448.55 g/mol. Its IUPAC name is 4-[6-(aminosulfanylamino)hexanoylamino]benzoic acid;benzyl carbamate.
| Compound Name | 4-[6-(aminosulfanylamino)hexanoylamino]benzoic acid;benzyl carbamate |
|---|---|
| PubChem CID | 143593142 |
| Molecular Formula | C21H28N4O5S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 4-[6-(aminosulfanylamino)hexanoylamino]benzoic acid;benzyl carbamate |
| SMILES | NC(=O)OCc1ccccc1.NSNCCCCCC(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C13H19N3O3S.C8H9NO2/c14-20-15-9-3-1-2-4-12(17)16-11-7-5-10(6-8-11)13(18)19;9-8(10)11-6-7-4-2-1-3-5-7/h5-8,15H,1-4,9,14H2,(H,16,17)(H,18,19);1-5H,6H2,(H2,9,10) |
| InChIKey | FWIPGRDZQJVDDX-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 156.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|