C10H9N3O2S — CID 163271022
5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carbaldehyde (PubChem CID 163271022) has the molecular formula C10H9N3O2S and a molecular weight of 235.27 g/mol. Its IUPAC name is 5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carbaldehyde.
| Compound Name | 5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 163271022 |
| Molecular Formula | C10H9N3O2S |
| Molecular Weight | 235.27 g/mol |
| Exact Mass | 235.04 |
| IUPAC Name | 5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carbaldehyde |
| SMILES | CCOc1cncc(-c2cnc(C=O)s2)n1 |
| InChI | InChI=1S/C10H9N3O2S/c1-2-15-9-5-11-3-7(13-9)8-4-12-10(6-14)16-8/h3-6H,2H2,1H3 |
| InChIKey | NIHHJDCRVZYANX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|