C26H37N7O2S2 — CID 163271905
N-cyclopropylsulfanyl-2-(methylaminomethyl)pyridin-4-amine;N,N-dimethylcyclobutanamine;5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carbaldehyde (PubChem CID 163271905) has the molecular formula C26H37N7O2S2 and a molecular weight of 543.76 g/mol. Its IUPAC name is N-cyclopropylsulfanyl-2-(methylaminomethyl)pyridin-4-amine;N,N-dimethylcyclobutanamine;5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carbaldehyde.
| Compound Name | N-cyclopropylsulfanyl-2-(methylaminomethyl)pyridin-4-amine;N,N-dimethylcyclobutanamine;5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 163271905 |
| Molecular Formula | C26H37N7O2S2 |
| Molecular Weight | 543.76 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | N-cyclopropylsulfanyl-2-(methylaminomethyl)pyridin-4-amine;N,N-dimethylcyclobutanamine;5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carbaldehyde |
| SMILES | CCOc1cncc(-c2cnc(C=O)s2)n1.CN(C)C1CCC1.CNCc1cc(NSC2CC2)ccn1 |
| InChI | InChI=1S/C10H9N3O2S.C10H15N3S.C6H13N/c1-2-15-9-5-11-3-7(13-9)8-4-12-10(6-14)16-8;1-11-7-9-6-8(4-5-12-9)13-14-10-2-3-10;1-7(2)6-4-3-5-6/h3-6H,2H2,1H3;4-6,10-11H,2-3,7H2,1H3,(H,12,13);6H,3-5H2,1-2H3 |
| InChIKey | NGRPGMLDRICARH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.76 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|