C19H16F3N5OS2 — CID 163271267
N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-5-[5-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-2-carboxamide (PubChem CID 163271267) has the molecular formula C19H16F3N5OS2 and a molecular weight of 451.50 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-5-[5-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-2-carboxamide.
| Compound Name | N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-5-[5-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 163271267 |
| Molecular Formula | C19H16F3N5OS2 |
| Molecular Weight | 451.50 g/mol |
| Exact Mass | 451.07 |
| IUPAC Name | N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-5-[5-(trifluoromethyl)-3-pyridinyl]-1,3-thiazole-2-carboxamide |
| SMILES | O=C(NCc1cc(NSC2CC2)ccn1)c1ncc(-c2cncc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C19H16F3N5OS2/c20-19(21,22)12-5-11(7-23-8-12)16-10-26-18(29-16)17(28)25-9-14-6-13(3-4-24-14)27-30-15-1-2-15/h3-8,10,15H,1-2,9H2,(H,24,27)(H,25,28) |
| InChIKey | HTKZFZYWPFNMCU-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|