C19H20N6O3S — CID 163271841
N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-2-(6-ethoxypyrazin-2-yl)-1,3-oxazole-5-carboxamide (PubChem CID 163271841) has the molecular formula C19H20N6O3S and a molecular weight of 412.48 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-2-(6-ethoxypyrazin-2-yl)-1,3-oxazole-5-carboxamide.
| Compound Name | N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-2-(6-ethoxypyrazin-2-yl)-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 163271841 |
| Molecular Formula | C19H20N6O3S |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-2-(6-ethoxypyrazin-2-yl)-1,3-oxazole-5-carboxamide |
| SMILES | CCOc1cncc(-c2ncc(C(=O)NCc3cc(NSC4CC4)ccn3)o2)n1 |
| InChI | InChI=1S/C19H20N6O3S/c1-2-27-17-11-20-9-15(24-17)19-23-10-16(28-19)18(26)22-8-13-7-12(5-6-21-13)25-29-14-3-4-14/h5-7,9-11,14H,2-4,8H2,1H3,(H,21,25)(H,22,26) |
| InChIKey | QWROCIVDARDJDU-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|