C24H28N6O3S — CID 155733971
2-[2-(cyclopropylsulfanylamino)pyrimidin-4-yl]-N-[4-(6-ethoxypyrazin-2-yl)phenyl]-4-methoxybutanamide (PubChem CID 155733971) has the molecular formula C24H28N6O3S and a molecular weight of 480.59 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfanylamino)pyrimidin-4-yl]-N-[4-(6-ethoxypyrazin-2-yl)phenyl]-4-methoxybutanamide.
| Compound Name | 2-[2-(cyclopropylsulfanylamino)pyrimidin-4-yl]-N-[4-(6-ethoxypyrazin-2-yl)phenyl]-4-methoxybutanamide |
|---|---|
| PubChem CID | 155733971 |
| Molecular Formula | C24H28N6O3S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2-[2-(cyclopropylsulfanylamino)pyrimidin-4-yl]-N-[4-(6-ethoxypyrazin-2-yl)phenyl]-4-methoxybutanamide |
| SMILES | CCOc1cncc(-c2ccc(NC(=O)C(CCOC)c3ccnc(NSC4CC4)n3)cc2)n1 |
| InChI | InChI=1S/C24H28N6O3S/c1-3-33-22-15-25-14-21(28-22)16-4-6-17(7-5-16)27-23(31)19(11-13-32-2)20-10-12-26-24(29-20)30-34-18-8-9-18/h4-7,10,12,14-15,18-19H,3,8-9,11,13H2,1-2H3,(H,27,31)(H,26,29,30) |
| InChIKey | LAHMBNCZAWDEMM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|