C22H24FN7O2S — CID 139515537
2-[2-(cyclopropylsulfanylamino)pyrimidin-4-yl]-N-[5-(6-ethoxypyrazin-2-yl)-3-fluoro-2-pyridinyl]-2-methylpropanamide (PubChem CID 139515537) has the molecular formula C22H24FN7O2S and a molecular weight of 469.55 g/mol. Its IUPAC name is 2-[2-(cyclopropylsulfanylamino)pyrimidin-4-yl]-N-[5-(6-ethoxypyrazin-2-yl)-3-fluoro-2-pyridinyl]-2-methylpropanamide.
| Compound Name | 2-[2-(cyclopropylsulfanylamino)pyrimidin-4-yl]-N-[5-(6-ethoxypyrazin-2-yl)-3-fluoro-2-pyridinyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 139515537 |
| Molecular Formula | C22H24FN7O2S |
| Molecular Weight | 469.55 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 2-[2-(cyclopropylsulfanylamino)pyrimidin-4-yl]-N-[5-(6-ethoxypyrazin-2-yl)-3-fluoro-2-pyridinyl]-2-methylpropanamide |
| SMILES | CCOc1cncc(-c2cnc(NC(=O)C(C)(C)c3ccnc(NSC4CC4)n3)c(F)c2)n1 |
| InChI | InChI=1S/C22H24FN7O2S/c1-4-32-18-12-24-11-16(27-18)13-9-15(23)19(26-10-13)29-20(31)22(2,3)17-7-8-25-21(28-17)30-33-14-5-6-14/h7-12,14H,4-6H2,1-3H3,(H,25,28,30)(H,26,29,31) |
| InChIKey | HBSKUXNHISBNKE-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|