C22H25FN6O2S — CID 139515541
N-[4-(6-ethoxypyrazin-2-yl)-2-fluorophenyl]-2-[2-(ethylsulfanylamino)pyrimidin-4-yl]-2-methylpropanamide (PubChem CID 139515541) has the molecular formula C22H25FN6O2S and a molecular weight of 456.55 g/mol. Its IUPAC name is N-[4-(6-ethoxypyrazin-2-yl)-2-fluorophenyl]-2-[2-(ethylsulfanylamino)pyrimidin-4-yl]-2-methylpropanamide.
| Compound Name | N-[4-(6-ethoxypyrazin-2-yl)-2-fluorophenyl]-2-[2-(ethylsulfanylamino)pyrimidin-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 139515541 |
| Molecular Formula | C22H25FN6O2S |
| Molecular Weight | 456.55 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | N-[4-(6-ethoxypyrazin-2-yl)-2-fluorophenyl]-2-[2-(ethylsulfanylamino)pyrimidin-4-yl]-2-methylpropanamide |
| SMILES | CCOc1cncc(-c2ccc(NC(=O)C(C)(C)c3ccnc(NSCC)n3)c(F)c2)n1 |
| InChI | InChI=1S/C22H25FN6O2S/c1-5-31-19-13-24-12-17(26-19)14-7-8-16(15(23)11-14)27-20(30)22(3,4)18-9-10-25-21(28-18)29-32-6-2/h7-13H,5-6H2,1-4H3,(H,27,30)(H,25,28,29) |
| InChIKey | QFSQWHPMJLABIB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|