C23H29N5O2S2 — CID 138701240
N-[4-(6-ethoxypyrazin-2-yl)phenyl]-2-methyl-2-[2-(2-methylpropylsulfanylamino)-1,3-thiazol-4-yl]propanamide (PubChem CID 138701240) has the molecular formula C23H29N5O2S2 and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[4-(6-ethoxypyrazin-2-yl)phenyl]-2-methyl-2-[2-(2-methylpropylsulfanylamino)-1,3-thiazol-4-yl]propanamide.
| Compound Name | N-[4-(6-ethoxypyrazin-2-yl)phenyl]-2-methyl-2-[2-(2-methylpropylsulfanylamino)-1,3-thiazol-4-yl]propanamide |
|---|---|
| PubChem CID | 138701240 |
| Molecular Formula | C23H29N5O2S2 |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | N-[4-(6-ethoxypyrazin-2-yl)phenyl]-2-methyl-2-[2-(2-methylpropylsulfanylamino)-1,3-thiazol-4-yl]propanamide |
| SMILES | CCOc1cncc(-c2ccc(NC(=O)C(C)(C)c3csc(NSCC(C)C)n3)cc2)n1 |
| InChI | InChI=1S/C23H29N5O2S2/c1-6-30-20-12-24-11-18(26-20)16-7-9-17(10-8-16)25-21(29)23(4,5)19-14-31-22(27-19)28-32-13-15(2)3/h7-12,14-15H,6,13H2,1-5H3,(H,25,29)(H,27,28) |
| InChIKey | REGGDJNPLDFNFM-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|