C24H28N6O2S — CID 139515540
2-[2-(cyclobutylsulfanylamino)pyrimidin-4-yl]-N-[4-(6-ethoxypyrazin-2-yl)phenyl]-2-methylpropanamide (PubChem CID 139515540) has the molecular formula C24H28N6O2S and a molecular weight of 464.60 g/mol. Its IUPAC name is 2-[2-(cyclobutylsulfanylamino)pyrimidin-4-yl]-N-[4-(6-ethoxypyrazin-2-yl)phenyl]-2-methylpropanamide.
| Compound Name | 2-[2-(cyclobutylsulfanylamino)pyrimidin-4-yl]-N-[4-(6-ethoxypyrazin-2-yl)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 139515540 |
| Molecular Formula | C24H28N6O2S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | 2-[2-(cyclobutylsulfanylamino)pyrimidin-4-yl]-N-[4-(6-ethoxypyrazin-2-yl)phenyl]-2-methylpropanamide |
| SMILES | CCOc1cncc(-c2ccc(NC(=O)C(C)(C)c3ccnc(NSC4CCC4)n3)cc2)n1 |
| InChI | InChI=1S/C24H28N6O2S/c1-4-32-21-15-25-14-19(28-21)16-8-10-17(11-9-16)27-22(31)24(2,3)20-12-13-26-23(29-20)30-33-18-6-5-7-18/h8-15,18H,4-7H2,1-3H3,(H,27,31)(H,26,29,30) |
| InChIKey | CLXDMZXIACGQLU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|