C21H22N6O2S2 — CID 169251274
N-[1-[4-(cyclopropylsulfanylamino)-2-pyridinyl]cyclopropyl]-5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carboxamide (PubChem CID 169251274) has the molecular formula C21H22N6O2S2 and a molecular weight of 454.58 g/mol. Its IUPAC name is N-[1-[4-(cyclopropylsulfanylamino)-2-pyridinyl]cyclopropyl]-5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-[1-[4-(cyclopropylsulfanylamino)-2-pyridinyl]cyclopropyl]-5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 169251274 |
| Molecular Formula | C21H22N6O2S2 |
| Molecular Weight | 454.58 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[1-[4-(cyclopropylsulfanylamino)-2-pyridinyl]cyclopropyl]-5-(6-ethoxypyrazin-2-yl)-1,3-thiazole-2-carboxamide |
| SMILES | CCOc1cncc(-c2cnc(C(=O)NC3(c4cc(NSC5CC5)ccn4)CC3)s2)n1 |
| InChI | InChI=1S/C21H22N6O2S2/c1-2-29-18-12-22-10-15(25-18)16-11-24-20(30-16)19(28)26-21(6-7-21)17-9-13(5-8-23-17)27-31-14-3-4-14/h5,8-12,14H,2-4,6-7H2,1H3,(H,23,27)(H,26,28) |
| InChIKey | SBULPBQBTDRRRF-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 101.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|