C11H11FN4O — CID 138673732
5-(6-ethoxypyrazin-2-yl)-3-fluoropyridin-2-amine (PubChem CID 138673732) has the molecular formula C11H11FN4O and a molecular weight of 234.23 g/mol. Its IUPAC name is 5-(6-ethoxypyrazin-2-yl)-3-fluoropyridin-2-amine.
| Compound Name | 5-(6-ethoxypyrazin-2-yl)-3-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 138673732 |
| Molecular Formula | C11H11FN4O |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-(6-ethoxypyrazin-2-yl)-3-fluoropyridin-2-amine |
| SMILES | CCOc1cncc(-c2cnc(N)c(F)c2)n1 |
| InChI | InChI=1S/C11H11FN4O/c1-2-17-10-6-14-5-9(16-10)7-3-8(12)11(13)15-4-7/h3-6H,2H2,1H3,(H2,13,15) |
| InChIKey | UEBMCKIUONBDEP-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |