C24H26N6O2S — CID 163271872
N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-4-[6-(3-methoxyazetidin-1-yl)pyrazin-2-yl]benzamide (PubChem CID 163271872) has the molecular formula C24H26N6O2S and a molecular weight of 462.58 g/mol. Its IUPAC name is N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-4-[6-(3-methoxyazetidin-1-yl)pyrazin-2-yl]benzamide.
| Compound Name | N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-4-[6-(3-methoxyazetidin-1-yl)pyrazin-2-yl]benzamide |
|---|---|
| PubChem CID | 163271872 |
| Molecular Formula | C24H26N6O2S |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | N-[[4-(cyclopropylsulfanylamino)-2-pyridinyl]methyl]-4-[6-(3-methoxyazetidin-1-yl)pyrazin-2-yl]benzamide |
| SMILES | COC1CN(c2cncc(-c3ccc(C(=O)NCc4cc(NSC5CC5)ccn4)cc3)n2)C1 |
| InChI | InChI=1S/C24H26N6O2S/c1-32-20-14-30(15-20)23-13-25-12-22(28-23)16-2-4-17(5-3-16)24(31)27-11-19-10-18(8-9-26-19)29-33-21-6-7-21/h2-5,8-10,12-13,20-21H,6-7,11,14-15H2,1H3,(H,26,29)(H,27,31) |
| InChIKey | IXXNORBHNHKTGH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|