C23H31N5O2S2 — CID 163271053
N-[(3E)-4-(cyclopropylsulfanylamino)-2-methyliminohexa-3,5-dienyl]-5-(5-ethoxy-3-pyridinyl)-1,3-thiazole-2-carboxamide;ethane (PubChem CID 163271053) has the molecular formula C23H31N5O2S2 and a molecular weight of 473.67 g/mol. Its IUPAC name is N-[(3E)-4-(cyclopropylsulfanylamino)-2-methyliminohexa-3,5-dienyl]-5-(5-ethoxy-3-pyridinyl)-1,3-thiazole-2-carboxamide;ethane.
| Compound Name | N-[(3E)-4-(cyclopropylsulfanylamino)-2-methyliminohexa-3,5-dienyl]-5-(5-ethoxy-3-pyridinyl)-1,3-thiazole-2-carboxamide;ethane |
|---|---|
| PubChem CID | 163271053 |
| Molecular Formula | C23H31N5O2S2 |
| Molecular Weight | 473.67 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | N-[(3E)-4-(cyclopropylsulfanylamino)-2-methyliminohexa-3,5-dienyl]-5-(5-ethoxy-3-pyridinyl)-1,3-thiazole-2-carboxamide;ethane |
| SMILES | C=C/C(=C\C(CNC(=O)c1ncc(-c2cncc(OCC)c2)s1)=N/C)NSC1CC1.CC |
| InChI | InChI=1S/C21H25N5O2S2.C2H6/c1-4-15(26-30-18-6-7-18)9-16(22-3)11-24-20(27)21-25-13-19(29-21)14-8-17(28-5-2)12-23-10-14;1-2/h4,8-10,12-13,18,26H,1,5-7,11H2,2-3H3,(H,24,27);1-2H3/b15-9+,22-16+; |
| InChIKey | MQDDIBXGAVUCDR-PYFQTOIMSA-N |
| XLogP | 4.90 |
| TPSA | 88.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|