C22H23N5O4S — CID 163271297
N-[[5-(cyclopropylsulfonylamino)-3-pyridinyl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide (PubChem CID 163271297) has the molecular formula C22H23N5O4S and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[[5-(cyclopropylsulfonylamino)-3-pyridinyl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide.
| Compound Name | N-[[5-(cyclopropylsulfonylamino)-3-pyridinyl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 163271297 |
| Molecular Formula | C22H23N5O4S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | N-[[5-(cyclopropylsulfonylamino)-3-pyridinyl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide |
| SMILES | CCOc1cncc(-c2ccc(C(=O)NCc3cncc(NS(=O)(=O)C4CC4)c3)cc2)n1 |
| InChI | InChI=1S/C22H23N5O4S/c1-2-31-21-14-24-13-20(26-21)16-3-5-17(6-4-16)22(28)25-11-15-9-18(12-23-10-15)27-32(29,30)19-7-8-19/h3-6,9-10,12-14,19,27H,2,7-8,11H2,1H3,(H,25,28) |
| InChIKey | XGQKBRABYQBGRJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 123.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |