C21H20F2N4O4S — CID 163271090
N-[[3-(difluoromethylsulfonylamino)phenyl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide (PubChem CID 163271090) has the molecular formula C21H20F2N4O4S and a molecular weight of 462.48 g/mol. Its IUPAC name is N-[[3-(difluoromethylsulfonylamino)phenyl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide.
| Compound Name | N-[[3-(difluoromethylsulfonylamino)phenyl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide |
|---|---|
| PubChem CID | 163271090 |
| Molecular Formula | C21H20F2N4O4S |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | N-[[3-(difluoromethylsulfonylamino)phenyl]methyl]-4-(6-ethoxypyrazin-2-yl)benzamide |
| SMILES | CCOc1cncc(-c2ccc(C(=O)NCc3cccc(NS(=O)(=O)C(F)F)c3)cc2)n1 |
| InChI | InChI=1S/C21H20F2N4O4S/c1-2-31-19-13-24-12-18(26-19)15-6-8-16(9-7-15)20(28)25-11-14-4-3-5-17(10-14)27-32(29,30)21(22)23/h3-10,12-13,21,27H,2,11H2,1H3,(H,25,28) |
| InChIKey | SRUFSCMMKLNDHA-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |