About fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione
fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione (PubChem CID 163274221) has the molecular formula C20H22FN5O2
and a molecular weight of 383.43 g/mol. Its IUPAC name is fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 163274221 |
| Molecular Formula | C20H22FN5O2 |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1nnc(-c2c[nH]c(=O)[nH]c2=O)cc1N1CCCCC1.Fc1ccccc1 |
| InChI | InChI=1S/C14H17N5O2.C6H5F/c1-9-12(19-5-3-2-4-6-19)7-11(18-17-9)10-8-15-14(21)16-13(10)20;7-6-4-2-1-3-5-6/h7-8H,2-6H2,1H3,(H2,15,16,20,21);1-5H |
| InChIKey | QFULSUHSFBPGKP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione?
The IUPAC name of fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione (CID 163274221) is fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione is Cc1nnc(-c2c[nH]c(=O)[nH]c2=O)cc1N1CCCCC1.Fc1ccccc1.
What is the InChIKey of fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione?
The InChIKey is QFULSUHSFBPGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O2.C6H5F/c1-9-12(19-5-3-2-4-6-19)7-11(18-17-9)10-8-15-14(21)16-13(10)20;7-6-4-2-1-3-5-6/h7-8H,2-6H2,1H3,(H2,15,16,20,21);1-5H.
What are the key properties of fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione?
fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione has a molecular weight of 383.43 g/mol, XLogP of 2.64, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;5-(6-methyl-5-piperidin-1-ylpyridazin-3-yl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 163274221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).