C18H17FN5O2P — CID 170786568
5-[5-[N-[1-(4-fluorophenyl)ethyl]-C-phosphanylcarbonimidoyl]-6-methylpyridazin-3-yl]-1H-pyrimidine-2,4-dione (PubChem CID 170786568) has the molecular formula C18H17FN5O2P and a molecular weight of 385.34 g/mol. Its IUPAC name is 5-[5-[N-[1-(4-fluorophenyl)ethyl]-C-phosphanylcarbonimidoyl]-6-methylpyridazin-3-yl]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-[5-[N-[1-(4-fluorophenyl)ethyl]-C-phosphanylcarbonimidoyl]-6-methylpyridazin-3-yl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170786568 |
| Molecular Formula | C18H17FN5O2P |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 5-[5-[N-[1-(4-fluorophenyl)ethyl]-C-phosphanylcarbonimidoyl]-6-methylpyridazin-3-yl]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1nnc(-c2c[nH]c(=O)[nH]c2=O)cc1/C(P)=N/C(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H17FN5O2P/c1-9(11-3-5-12(19)6-4-11)21-17(27)13-7-15(24-23-10(13)2)14-8-20-18(26)22-16(14)25/h3-9H,27H2,1-2H3,(H2,20,22,25,26)/b21-17- |
| InChIKey | BKFFOUTXDUPQEC-FXBPSFAMSA-N |
| XLogP | 2.35 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|