About CID 163274301
CID 163274301 (PubChem CID 163274301) has the molecular formula C12H12BClO2
and a molecular weight of 234.49 g/mol.
Molecular Properties
| Compound Name | CID 163274301 |
| PubChem CID | 163274301 |
| Molecular Formula | C12H12BClO2 |
| Molecular Weight | 234.49 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | — |
| SMILES | [B]CC(=O)OC1(C)Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C12H12BClO2/c1-12(16-11(15)7-13)5-8-2-3-10(14)4-9(8)6-12/h2-4H,5-7H2,1H3 |
| InChIKey | AUCDIMZLLOGMCV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 163274301 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163274301?
The IUPAC name of CID 163274301 (CID 163274301) is not available.
What is the SMILES notation for CID 163274301?
The canonical SMILES for CID 163274301 is [B]CC(=O)OC1(C)Cc2ccc(Cl)cc2C1.
What is the InChIKey of CID 163274301?
The InChIKey is AUCDIMZLLOGMCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BClO2/c1-12(16-11(15)7-13)5-8-2-3-10(14)4-9(8)6-12/h2-4H,5-7H2,1H3.
What are the key properties of CID 163274301?
CID 163274301 has a molecular weight of 234.49 g/mol, XLogP of 2.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163274301 is sourced from PubChem (CID 163274301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).