C23H28FN5O — CID 163274493
2-(2-aminoethanimidoyl)-4-[4-fluoro-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethoxy]phenyl]-N-methylaniline (PubChem CID 163274493) has the molecular formula C23H28FN5O and a molecular weight of 409.51 g/mol. Its IUPAC name is 2-(2-aminoethanimidoyl)-4-[4-fluoro-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethoxy]phenyl]-N-methylaniline.
| Compound Name | 2-(2-aminoethanimidoyl)-4-[4-fluoro-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethoxy]phenyl]-N-methylaniline |
|---|---|
| PubChem CID | 163274493 |
| Molecular Formula | C23H28FN5O |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 2-(2-aminoethanimidoyl)-4-[4-fluoro-2-[2-(1,3,5-trimethylpyrazol-4-yl)ethoxy]phenyl]-N-methylaniline |
| SMILES | [H]/N=C(\CN)c1cc(-c2ccc(F)cc2OCCc2c(C)nn(C)c2C)ccc1NC |
| InChI | InChI=1S/C23H28FN5O/c1-14-18(15(2)29(4)28-14)9-10-30-23-12-17(24)6-7-19(23)16-5-8-22(27-3)20(11-16)21(26)13-25/h5-8,11-12,26-27H,9-10,13,25H2,1-4H3/b26-21+ |
| InChIKey | GUTPSDNQUIACAR-YYADALCUSA-N |
| XLogP | 3.83 |
| TPSA | 88.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|