C14H17FN4S — CID 79242452
5-fluoro-2-[(1,3,5-trimethylpyrazol-4-yl)methylamino]benzenecarbothioamide (PubChem CID 79242452) has the molecular formula C14H17FN4S and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-fluoro-2-[(1,3,5-trimethylpyrazol-4-yl)methylamino]benzenecarbothioamide.
| Compound Name | 5-fluoro-2-[(1,3,5-trimethylpyrazol-4-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 79242452 |
| Molecular Formula | C14H17FN4S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 5-fluoro-2-[(1,3,5-trimethylpyrazol-4-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1nn(C)c(C)c1CNc1ccc(F)cc1C(N)=S |
| InChI | InChI=1S/C14H17FN4S/c1-8-12(9(2)19(3)18-8)7-17-13-5-4-10(15)6-11(13)14(16)20/h4-6,17H,7H2,1-3H3,(H2,16,20) |
| InChIKey | RAIZDJCZGGTYIW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|