C15H18ClF3N6O2S — CID 163274873
7-chloro-5-methyl-4-[6-[sulfamoyl(2,2,2-trifluoroethyl)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine (PubChem CID 163274873) has the molecular formula C15H18ClF3N6O2S and a molecular weight of 438.86 g/mol. Its IUPAC name is 7-chloro-5-methyl-4-[6-[sulfamoyl(2,2,2-trifluoroethyl)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine.
| Compound Name | 7-chloro-5-methyl-4-[6-[sulfamoyl(2,2,2-trifluoroethyl)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine |
|---|---|
| PubChem CID | 163274873 |
| Molecular Formula | C15H18ClF3N6O2S |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 7-chloro-5-methyl-4-[6-[sulfamoyl(2,2,2-trifluoroethyl)amino]-2-azaspiro[3.3]heptan-2-yl]pyrrolo[2,1-f][1,2,4]triazine |
| SMILES | Cc1cc(Cl)n2ncnc(N3CC4(CC(N(CC(F)(F)F)S(N)(=O)=O)C4)C3)c12 |
| InChI | InChI=1S/C15H18ClF3N6O2S/c1-9-2-11(16)25-12(9)13(21-8-22-25)23-5-14(6-23)3-10(4-14)24(28(20,26)27)7-15(17,18)19/h2,8,10H,3-7H2,1H3,(H2,20,26,27) |
| InChIKey | GVZWULKBARKAOV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 96.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |