C25H24FN3O5 — CID 163276390
10-ethyl-18-fluoro-23-hydroxy-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione;formamide (PubChem CID 163276390) has the molecular formula C25H24FN3O5 and a molecular weight of 465.48 g/mol. Its IUPAC name is 10-ethyl-18-fluoro-23-hydroxy-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione;formamide.
| Compound Name | 10-ethyl-18-fluoro-23-hydroxy-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione;formamide |
|---|---|
| PubChem CID | 163276390 |
| Molecular Formula | C25H24FN3O5 |
| Molecular Weight | 465.48 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 10-ethyl-18-fluoro-23-hydroxy-19-methyl-8-oxa-4,15-diazahexacyclo[14.7.1.02,14.04,13.06,11.020,24]tetracosa-1,6(11),12,14,16,18,20(24)-heptaene-5,9-dione;formamide |
| SMILES | CCC1C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)c3c1c2C(O)CC3.NC=O |
| InChI | InChI=1S/C24H21FN2O4.CH3NO/c1-3-11-13-6-18-22-14(8-27(18)23(29)15(13)9-31-24(11)30)21-19(28)5-4-12-10(2)16(25)7-17(26-22)20(12)21;2-1-3/h6-7,11,19,28H,3-5,8-9H2,1-2H3;1H,(H2,2,3) |
| InChIKey | BFCQCPDWTBKTSH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.48 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|